C29H38FN3O6 — CID 67137341
4-[3-tert-butyl-5-[2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)acetyl]-2-methoxyphenoxy]butanamide (PubChem CID 67137341) has the molecular formula C29H38FN3O6 and a molecular weight of 543.64 g/mol. Its IUPAC name is 4-[3-tert-butyl-5-[2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)acetyl]-2-methoxyphenoxy]butanamide.
| Compound Name | 4-[3-tert-butyl-5-[2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)acetyl]-2-methoxyphenoxy]butanamide |
|---|---|
| PubChem CID | 67137341 |
| Molecular Formula | C29H38FN3O6 |
| Molecular Weight | 543.64 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | 4-[3-tert-butyl-5-[2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)acetyl]-2-methoxyphenoxy]butanamide |
| SMILES | [H]/N=C1/c2c(cc(OCC)c(OCC)c2F)CN1CC(=O)c1cc(OCCCC(N)=O)c(OC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H38FN3O6/c1-7-37-22-14-18-15-33(28(32)24(18)25(30)27(22)38-8-2)16-20(34)17-12-19(29(3,4)5)26(36-6)21(13-17)39-11-9-10-23(31)35/h12-14,32H,7-11,15-16H2,1-6H3,(H2,31,35)/b32-28- |
| InChIKey | HNZLIEJEHWMGLJ-BLCKFSMSSA-N |
| XLogP | 4.60 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.64 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|