C32H43FN2O5 — CID 143535348
1-[3-tert-butyl-4-methoxy-5-(oxocan-5-yl)phenyl]-2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)ethanone (PubChem CID 143535348) has the molecular formula C32H43FN2O5 and a molecular weight of 554.70 g/mol. Its IUPAC name is 1-[3-tert-butyl-4-methoxy-5-(oxocan-5-yl)phenyl]-2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)ethanone.
| Compound Name | 1-[3-tert-butyl-4-methoxy-5-(oxocan-5-yl)phenyl]-2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)ethanone |
|---|---|
| PubChem CID | 143535348 |
| Molecular Formula | C32H43FN2O5 |
| Molecular Weight | 554.70 g/mol |
| Exact Mass | 554.32 |
| IUPAC Name | 1-[3-tert-butyl-4-methoxy-5-(oxocan-5-yl)phenyl]-2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)ethanone |
| SMILES | [H]/N=C1/c2c(cc(OCC)c(OCC)c2F)CN1CC(=O)c1cc(C2CCCOCCC2)c(OC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C32H43FN2O5/c1-7-39-26-17-22-18-35(31(34)27(22)28(33)30(26)40-8-2)19-25(36)21-15-23(20-11-9-13-38-14-10-12-20)29(37-6)24(16-21)32(3,4)5/h15-17,20,34H,7-14,18-19H2,1-6H3/b34-31- |
| InChIKey | ANTXBJQVAKJNBW-NMSHJFGGSA-N |
| XLogP | 6.63 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.70 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|