C26H31FN2O4 — CID 67137295
1-(7-tert-butyl-2,3-dihydro-1-benzofuran-5-yl)-2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)ethanone (PubChem CID 67137295) has the molecular formula C26H31FN2O4 and a molecular weight of 454.54 g/mol. Its IUPAC name is 1-(7-tert-butyl-2,3-dihydro-1-benzofuran-5-yl)-2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)ethanone.
| Compound Name | 1-(7-tert-butyl-2,3-dihydro-1-benzofuran-5-yl)-2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)ethanone |
|---|---|
| PubChem CID | 67137295 |
| Molecular Formula | C26H31FN2O4 |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 1-(7-tert-butyl-2,3-dihydro-1-benzofuran-5-yl)-2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)ethanone |
| SMILES | [H]/N=C1/c2c(cc(OCC)c(OCC)c2F)CN1CC(=O)c1cc2c(c(C(C)(C)C)c1)OCC2 |
| InChI | InChI=1S/C26H31FN2O4/c1-6-31-20-12-17-13-29(25(28)21(17)22(27)24(20)32-7-2)14-19(30)16-10-15-8-9-33-23(15)18(11-16)26(3,4)5/h10-12,28H,6-9,13-14H2,1-5H3/b28-25- |
| InChIKey | UDZIFPYISLELAE-FVDSYPCUSA-N |
| XLogP | 4.88 |
| TPSA | 71.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|