C26H31BrFN3O4 — CID 67137347
2-[2-tert-butyl-4-[2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)acetyl]phenoxy]acetonitrile;hydrobromide (PubChem CID 67137347) has the molecular formula C26H31BrFN3O4 and a molecular weight of 548.45 g/mol. Its IUPAC name is 2-[2-tert-butyl-4-[2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)acetyl]phenoxy]acetonitrile;hydrobromide.
| Compound Name | 2-[2-tert-butyl-4-[2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)acetyl]phenoxy]acetonitrile;hydrobromide |
|---|---|
| PubChem CID | 67137347 |
| Molecular Formula | C26H31BrFN3O4 |
| Molecular Weight | 548.45 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | 2-[2-tert-butyl-4-[2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)acetyl]phenoxy]acetonitrile;hydrobromide |
| SMILES | Br.[H]/N=C1/c2c(cc(OCC)c(OCC)c2F)CN1CC(=O)c1ccc(OCC#N)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H30FN3O4.BrH/c1-6-32-21-13-17-14-30(25(29)22(17)23(27)24(21)33-7-2)15-19(31)16-8-9-20(34-11-10-28)18(12-16)26(3,4)5;/h8-9,12-13,29H,6-7,11,14-15H2,1-5H3;1H/b29-25-; |
| InChIKey | SQBDJPUCXMTKSG-PKPTZPFZSA-N |
| XLogP | 5.42 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.45 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|