C26H31FN2O5 — CID 25102154
[2-tert-butyl-4-[2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)acetyl]phenyl] acetate (PubChem CID 25102154) has the molecular formula C26H31FN2O5 and a molecular weight of 470.54 g/mol. Its IUPAC name is [2-tert-butyl-4-[2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)acetyl]phenyl] acetate.
| Compound Name | [2-tert-butyl-4-[2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)acetyl]phenyl] acetate |
|---|---|
| PubChem CID | 25102154 |
| Molecular Formula | C26H31FN2O5 |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | [2-tert-butyl-4-[2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)acetyl]phenyl] acetate |
| SMILES | [H]/N=C1/c2c(cc(OCC)c(OCC)c2F)CN1CC(=O)c1ccc(OC(C)=O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H31FN2O5/c1-7-32-21-12-17-13-29(25(28)22(17)23(27)24(21)33-8-2)14-19(31)16-9-10-20(34-15(3)30)18(11-16)26(4,5)6/h9-12,28H,7-8,13-14H2,1-6H3/b28-25- |
| InChIKey | RBDOLCLKGNPEMO-FVDSYPCUSA-N |
| XLogP | 4.87 |
| TPSA | 88.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|