C30H41N3O5 — CID 87843901
2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]-4,6-diethoxy-3-imino-N-methyl-1H-isoindole-5-carboxamide (PubChem CID 87843901) has the molecular formula C30H41N3O5 and a molecular weight of 523.67 g/mol. Its IUPAC name is 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]-4,6-diethoxy-3-imino-N-methyl-1H-isoindole-5-carboxamide.
| Compound Name | 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]-4,6-diethoxy-3-imino-N-methyl-1H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 87843901 |
| Molecular Formula | C30H41N3O5 |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.30 |
| IUPAC Name | 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]-4,6-diethoxy-3-imino-N-methyl-1H-isoindole-5-carboxamide |
| SMILES | [H]/N=C1/c2c(cc(OCC)c(C(=O)NC)c2OCC)CN1CC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H41N3O5/c1-10-37-22-14-18-15-33(27(31)23(18)26(38-11-2)24(22)28(36)32-9)16-21(34)17-12-19(29(3,4)5)25(35)20(13-17)30(6,7)8/h12-14,31,35H,10-11,15-16H2,1-9H3,(H,32,36)/b31-27- |
| InChIKey | XIYPEMHYLMWLRZ-QVTSOHHYSA-N |
| XLogP | 5.17 |
| TPSA | 111.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|