C26H34N4O4 — CID 87284452
2-[2-[3-tert-butyl-4-hydroxy-5-(methylaminomethyl)phenyl]-2-oxoethyl]-6-ethoxy-3-imino-N-methyl-1H-isoindole-5-carboxamide (PubChem CID 87284452) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is 2-[2-[3-tert-butyl-4-hydroxy-5-(methylaminomethyl)phenyl]-2-oxoethyl]-6-ethoxy-3-imino-N-methyl-1H-isoindole-5-carboxamide.
| Compound Name | 2-[2-[3-tert-butyl-4-hydroxy-5-(methylaminomethyl)phenyl]-2-oxoethyl]-6-ethoxy-3-imino-N-methyl-1H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 87284452 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 2-[2-[3-tert-butyl-4-hydroxy-5-(methylaminomethyl)phenyl]-2-oxoethyl]-6-ethoxy-3-imino-N-methyl-1H-isoindole-5-carboxamide |
| SMILES | [H]/N=C1/c2cc(C(=O)NC)c(OCC)cc2CN1CC(=O)c1cc(CNC)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H34N4O4/c1-7-34-22-10-17-13-30(24(27)18(17)11-19(22)25(33)29-6)14-21(31)15-8-16(12-28-5)23(32)20(9-15)26(2,3)4/h8-11,27-28,32H,7,12-14H2,1-6H3,(H,29,33)/b27-24- |
| InChIKey | CTXGCKGAZUYAKM-PNHLSOANSA-N |
| XLogP | 3.19 |
| TPSA | 114.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|