C25H30N4O5 — CID 67138577
6-ethoxy-2-[2-[4-hydroxy-3-methyl-5-[(2-oxopropylamino)methyl]phenyl]-2-oxoethyl]-3-imino-N-methyl-1H-isoindole-5-carboxamide (PubChem CID 67138577) has the molecular formula C25H30N4O5 and a molecular weight of 466.54 g/mol. Its IUPAC name is 6-ethoxy-2-[2-[4-hydroxy-3-methyl-5-[(2-oxopropylamino)methyl]phenyl]-2-oxoethyl]-3-imino-N-methyl-1H-isoindole-5-carboxamide.
| Compound Name | 6-ethoxy-2-[2-[4-hydroxy-3-methyl-5-[(2-oxopropylamino)methyl]phenyl]-2-oxoethyl]-3-imino-N-methyl-1H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 67138577 |
| Molecular Formula | C25H30N4O5 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 6-ethoxy-2-[2-[4-hydroxy-3-methyl-5-[(2-oxopropylamino)methyl]phenyl]-2-oxoethyl]-3-imino-N-methyl-1H-isoindole-5-carboxamide |
| SMILES | [H]/N=C1/c2cc(C(=O)NC)c(OCC)cc2CN1CC(=O)c1cc(C)c(O)c(CNCC(C)=O)c1 |
| InChI | InChI=1S/C25H30N4O5/c1-5-34-22-8-18-12-29(24(26)19(18)9-20(22)25(33)27-4)13-21(31)16-6-14(2)23(32)17(7-16)11-28-10-15(3)30/h6-9,26,28,32H,5,10-13H2,1-4H3,(H,27,33)/b26-24- |
| InChIKey | LQLCKOTYULLTNN-LCUIJRPUSA-N |
| XLogP | 2.16 |
| TPSA | 131.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|