C26H25N3O3 — CID 69460584
6-ethoxy-3-imino-N-methyl-2-[2-oxo-2-(3-phenylphenyl)ethyl]-1H-isoindole-5-carboxamide (PubChem CID 69460584) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is 6-ethoxy-3-imino-N-methyl-2-[2-oxo-2-(3-phenylphenyl)ethyl]-1H-isoindole-5-carboxamide.
| Compound Name | 6-ethoxy-3-imino-N-methyl-2-[2-oxo-2-(3-phenylphenyl)ethyl]-1H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 69460584 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 6-ethoxy-3-imino-N-methyl-2-[2-oxo-2-(3-phenylphenyl)ethyl]-1H-isoindole-5-carboxamide |
| SMILES | [H]/N=C1/c2cc(C(=O)NC)c(OCC)cc2CN1CC(=O)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C26H25N3O3/c1-3-32-24-13-20-15-29(25(27)21(20)14-22(24)26(31)28-2)16-23(30)19-11-7-10-18(12-19)17-8-5-4-6-9-17/h4-14,27H,3,15-16H2,1-2H3,(H,28,31)/b27-25- |
| InChIKey | XOVZCDAVJMUIOJ-RFBIWTDZSA-N |
| XLogP | 4.14 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|