C24H30BrN3O3 — CID 67136752
2-[2-(3-tert-butylphenyl)-2-oxoethyl]-6-ethoxy-3-imino-N-methyl-1H-isoindole-5-carboxamide;hydrobromide (PubChem CID 67136752) has the molecular formula C24H30BrN3O3 and a molecular weight of 488.43 g/mol. Its IUPAC name is 2-[2-(3-tert-butylphenyl)-2-oxoethyl]-6-ethoxy-3-imino-N-methyl-1H-isoindole-5-carboxamide;hydrobromide.
| Compound Name | 2-[2-(3-tert-butylphenyl)-2-oxoethyl]-6-ethoxy-3-imino-N-methyl-1H-isoindole-5-carboxamide;hydrobromide |
|---|---|
| PubChem CID | 67136752 |
| Molecular Formula | C24H30BrN3O3 |
| Molecular Weight | 488.43 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 2-[2-(3-tert-butylphenyl)-2-oxoethyl]-6-ethoxy-3-imino-N-methyl-1H-isoindole-5-carboxamide;hydrobromide |
| SMILES | Br.[H]/N=C1/c2cc(C(=O)NC)c(OCC)cc2CN1CC(=O)c1cccc(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H29N3O3.BrH/c1-6-30-21-11-16-13-27(22(25)18(16)12-19(21)23(29)26-5)14-20(28)15-8-7-9-17(10-15)24(2,3)4;/h7-12,25H,6,13-14H2,1-5H3,(H,26,29);1H/b25-22-; |
| InChIKey | ODICWEZMEICNKZ-SIZUISDESA-N |
| XLogP | 4.34 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|