C28H33N3O6 — CID 67138457
methyl 3-[2-tert-butyl-4-[2-[6-ethoxy-3-imino-5-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]phenoxy]prop-2-enoate (PubChem CID 67138457) has the molecular formula C28H33N3O6 and a molecular weight of 507.59 g/mol. Its IUPAC name is methyl 3-[2-tert-butyl-4-[2-[6-ethoxy-3-imino-5-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]phenoxy]prop-2-enoate.
| Compound Name | methyl 3-[2-tert-butyl-4-[2-[6-ethoxy-3-imino-5-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]phenoxy]prop-2-enoate |
|---|---|
| PubChem CID | 67138457 |
| Molecular Formula | C28H33N3O6 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | methyl 3-[2-tert-butyl-4-[2-[6-ethoxy-3-imino-5-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]phenoxy]prop-2-enoate |
| SMILES | [H]/N=C1/c2cc(C(=O)NC)c(OCC)cc2CN1CC(=O)c1ccc(OC=CC(=O)OC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H33N3O6/c1-7-36-24-13-18-15-31(26(29)19(18)14-20(24)27(34)30-5)16-22(32)17-8-9-23(21(12-17)28(2,3)4)37-11-10-25(33)35-6/h8-14,29H,7,15-16H2,1-6H3,(H,30,34)/b11-10?,29-26- |
| InChIKey | ITZQRUQCMYKMIU-FTPMKXASSA-N |
| XLogP | 3.83 |
| TPSA | 118.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|