C28H36N2O4 — CID 19022095
(3Z)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-N-methyl-2-oxo-N-phenylmethoxypyrrolidine-1-carboxamide (PubChem CID 19022095) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is (3Z)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-N-methyl-2-oxo-N-phenylmethoxypyrrolidine-1-carboxamide.
| Compound Name | (3Z)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-N-methyl-2-oxo-N-phenylmethoxypyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 19022095 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | (3Z)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-N-methyl-2-oxo-N-phenylmethoxypyrrolidine-1-carboxamide |
| SMILES | CN(OCc1ccccc1)C(=O)N1CC/C(=C/c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)C1=O |
| InChI | InChI=1S/C28H36N2O4/c1-27(2,3)22-16-20(17-23(24(22)31)28(4,5)6)15-21-13-14-30(25(21)32)26(33)29(7)34-18-19-11-9-8-10-12-19/h8-12,15-17,31H,13-14,18H2,1-7H3/b21-15- |
| InChIKey | HKMCALUXBCVKFT-QNGOZBTKSA-N |
| XLogP | 5.79 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|