C24H28N2O3 — CID 126027410
(5E)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-phenylimidazolidine-2,4-dione (PubChem CID 126027410) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is (5E)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-phenylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126027410 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (5E)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-phenylimidazolidine-2,4-dione |
| SMILES | CC(C)(C)c1cc(/C=C2/NC(=O)N(c3ccccc3)C2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C24H28N2O3/c1-23(2,3)17-12-15(13-18(20(17)27)24(4,5)6)14-19-21(28)26(22(29)25-19)16-10-8-7-9-11-16/h7-14,27H,1-6H3,(H,25,29)/b19-14+ |
| InChIKey | UKUAGUHZTRGJQU-XMHGGMMESA-N |
| XLogP | 5.08 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|