C17H13BrN2O4 — CID 2925977
5-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]-3-phenylimidazolidine-2,4-dione (PubChem CID 2925977) has the molecular formula C17H13BrN2O4 and a molecular weight of 389.21 g/mol. Its IUPAC name is 5-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]-3-phenylimidazolidine-2,4-dione.
| Compound Name | 5-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]-3-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2925977 |
| Molecular Formula | C17H13BrN2O4 |
| Molecular Weight | 389.21 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 5-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]-3-phenylimidazolidine-2,4-dione |
| SMILES | COc1cc(Br)cc(C=C2NC(=O)N(c3ccccc3)C2=O)c1O |
| InChI | InChI=1S/C17H13BrN2O4/c1-24-14-9-11(18)7-10(15(14)21)8-13-16(22)20(17(23)19-13)12-5-3-2-4-6-12/h2-9,21H,1H3,(H,19,23) |
| InChIKey | IZIYHNZAEVMRRM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.21 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|