C22H28O3 — CID 155676186
(6Z)-6-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-methoxycyclohexa-2,4-dien-1-one (PubChem CID 155676186) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is (6Z)-6-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-methoxycyclohexa-2,4-dien-1-one.
| Compound Name | (6Z)-6-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-methoxycyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 155676186 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (6Z)-6-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-methoxycyclohexa-2,4-dien-1-one |
| SMILES | COC1=CC(=O)/C(=C\c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)C=C1 |
| InChI | InChI=1S/C22H28O3/c1-21(2,3)17-11-14(12-18(20(17)24)22(4,5)6)10-15-8-9-16(25-7)13-19(15)23/h8-13,24H,1-7H3/b15-10- |
| InChIKey | XDYAMQLYGIGHIL-GDNBJRDFSA-N |
| XLogP | 5.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|