C20H26O3 — CID 75599197
2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-5-methylfuran-3-one (PubChem CID 75599197) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-5-methylfuran-3-one.
| Compound Name | 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-5-methylfuran-3-one |
|---|---|
| PubChem CID | 75599197 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-5-methylfuran-3-one |
| SMILES | CC1=CC(=O)C(=Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)O1 |
| InChI | InChI=1S/C20H26O3/c1-12-8-16(21)17(23-12)11-13-9-14(19(2,3)4)18(22)15(10-13)20(5,6)7/h8-11,22H,1-7H3 |
| InChIKey | WEGUIGJLONJAOB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|