About CID 102194577
CID 102194577 (PubChem CID 102194577) has the molecular formula C21H25F3NO
and a molecular weight of 364.43 g/mol.
Molecular Properties
| Compound Name | CID 102194577 |
| PubChem CID | 102194577 |
| Molecular Formula | C21H25F3NO |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc([N]c2ccccc2C(F)(F)F)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H25F3NO/c1-19(2,3)13-11-15(20(4,5)6)18(26)17(12-13)25-16-10-8-7-9-14(16)21(22,23)24/h7-12,26H,1-6H3 |
| InChIKey | BYMNCMFBMLJZJO-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 34.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 102194577 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102194577?
The IUPAC name of CID 102194577 (CID 102194577) is not available.
What is the SMILES notation for CID 102194577?
The canonical SMILES for CID 102194577 is CC(C)(C)c1cc([N]c2ccccc2C(F)(F)F)c(O)c(C(C)(C)C)c1.
What is the InChIKey of CID 102194577?
The InChIKey is BYMNCMFBMLJZJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25F3NO/c1-19(2,3)13-11-15(20(4,5)6)18(26)17(12-13)25-16-10-8-7-9-14(16)21(22,23)24/h7-12,26H,1-6H3.
What are the key properties of CID 102194577?
CID 102194577 has a molecular weight of 364.43 g/mol, XLogP of 6.57, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102194577 is sourced from PubChem (CID 102194577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).