C21H25F3NO — CID 102194577
CID 102194577 (PubChem CID 102194577) has the molecular formula C21H25F3NO and a molecular weight of 364.43 g/mol.
| Compound Name | CID 102194577 |
|---|---|
| PubChem CID | 102194577 |
| Molecular Formula | C21H25F3NO |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc([N]c2ccccc2C(F)(F)F)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H25F3NO/c1-19(2,3)13-11-15(20(4,5)6)18(26)17(12-13)25-16-10-8-7-9-14(16)21(22,23)24/h7-12,26H,1-6H3 |
| InChIKey | BYMNCMFBMLJZJO-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 34.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |