C27H31N3O2 — CID 177418158
2,4-ditert-butyl-6-[[6-[(2-hydroxyphenyl)iminomethyl]-2-pyridinyl]methylideneamino]phenol (PubChem CID 177418158) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[6-[(2-hydroxyphenyl)iminomethyl]-2-pyridinyl]methylideneamino]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[6-[(2-hydroxyphenyl)iminomethyl]-2-pyridinyl]methylideneamino]phenol |
|---|---|
| PubChem CID | 177418158 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 2,4-ditert-butyl-6-[[6-[(2-hydroxyphenyl)iminomethyl]-2-pyridinyl]methylideneamino]phenol |
| SMILES | CC(C)(C)c1cc(/N=C/c2cccc(/C=N/c3ccccc3O)n2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H31N3O2/c1-26(2,3)18-14-21(27(4,5)6)25(32)23(15-18)29-17-20-11-9-10-19(30-20)16-28-22-12-7-8-13-24(22)31/h7-17,31-32H,1-6H3/b28-16+,29-17+ |
| InChIKey | JNICMQHJMPARSR-LPHFKDDMSA-N |
| XLogP | 6.59 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|