C23H27NO2S — CID 135975994
2-[(3,5-ditert-butyl-2-hydroxyphenyl)iminomethyl]-1-benzothiophen-3-ol (PubChem CID 135975994) has the molecular formula C23H27NO2S and a molecular weight of 381.54 g/mol. Its IUPAC name is 2-[(3,5-ditert-butyl-2-hydroxyphenyl)iminomethyl]-1-benzothiophen-3-ol.
| Compound Name | 2-[(3,5-ditert-butyl-2-hydroxyphenyl)iminomethyl]-1-benzothiophen-3-ol |
|---|---|
| PubChem CID | 135975994 |
| Molecular Formula | C23H27NO2S |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 2-[(3,5-ditert-butyl-2-hydroxyphenyl)iminomethyl]-1-benzothiophen-3-ol |
| SMILES | CC(C)(C)c1cc(/N=C/c2sc3ccccc3c2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H27NO2S/c1-22(2,3)14-11-16(23(4,5)6)21(26)17(12-14)24-13-19-20(25)15-9-7-8-10-18(15)27-19/h7-13,25-26H,1-6H3/b24-13+ |
| InChIKey | QJLZJAAVIZOSEF-ZMOGYAJESA-N |
| XLogP | 6.66 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|