C13H8N2O3S2 — CID 137036922
2-[(3-hydroxy-1-benzothiophen-2-yl)methylideneamino]-1,3-thiazole-5-carboxylic acid (PubChem CID 137036922) has the molecular formula C13H8N2O3S2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-[(3-hydroxy-1-benzothiophen-2-yl)methylideneamino]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[(3-hydroxy-1-benzothiophen-2-yl)methylideneamino]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 137036922 |
| Molecular Formula | C13H8N2O3S2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | 2-[(3-hydroxy-1-benzothiophen-2-yl)methylideneamino]-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(N=Cc2sc3ccccc3c2O)s1 |
| InChI | InChI=1S/C13H8N2O3S2/c16-11-7-3-1-2-4-8(7)19-9(11)5-14-13-15-6-10(20-13)12(17)18/h1-6,16H,(H,17,18) |
| InChIKey | HCACKKKIKFLYDA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|