C13H10N4OS2 — CID 135972868
2-[(E)-(3-hydroxy-1-benzothiophen-2-yl)methylideneamino]-1,3-thiazole-5-carboximidamide (PubChem CID 135972868) has the molecular formula C13H10N4OS2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 2-[(E)-(3-hydroxy-1-benzothiophen-2-yl)methylideneamino]-1,3-thiazole-5-carboximidamide.
| Compound Name | 2-[(E)-(3-hydroxy-1-benzothiophen-2-yl)methylideneamino]-1,3-thiazole-5-carboximidamide |
|---|---|
| PubChem CID | 135972868 |
| Molecular Formula | C13H10N4OS2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 2-[(E)-(3-hydroxy-1-benzothiophen-2-yl)methylideneamino]-1,3-thiazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1cnc(/N=C/c2sc3ccccc3c2O)s1 |
| InChI | InChI=1S/C13H10N4OS2/c14-12(15)10-6-17-13(20-10)16-5-9-11(18)7-3-1-2-4-8(7)19-9/h1-6,18H,(H3,14,15)/b16-5+ |
| InChIKey | QSVUYHIPWIKIOY-FZSIALSZSA-N |
| XLogP | 3.10 |
| TPSA | 95.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|