C16H8F2N2OS2 — CID 137047782
2-[(4,6-difluoro-1,3-benzothiazol-2-yl)iminomethyl]-1-benzothiophen-3-ol (PubChem CID 137047782) has the molecular formula C16H8F2N2OS2 and a molecular weight of 346.38 g/mol. Its IUPAC name is 2-[(4,6-difluoro-1,3-benzothiazol-2-yl)iminomethyl]-1-benzothiophen-3-ol.
| Compound Name | 2-[(4,6-difluoro-1,3-benzothiazol-2-yl)iminomethyl]-1-benzothiophen-3-ol |
|---|---|
| PubChem CID | 137047782 |
| Molecular Formula | C16H8F2N2OS2 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 2-[(4,6-difluoro-1,3-benzothiazol-2-yl)iminomethyl]-1-benzothiophen-3-ol |
| SMILES | Oc1c(C=Nc2nc3c(F)cc(F)cc3s2)sc2ccccc12 |
| InChI | InChI=1S/C16H8F2N2OS2/c17-8-5-10(18)14-12(6-8)23-16(20-14)19-7-13-15(21)9-3-1-2-4-11(9)22-13/h1-7,21H |
| InChIKey | DIPKZXHYDBDFAR-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|