C18H18F3NO — CID 100965136
2-tert-butyl-6-[(2,2,2-trifluoro-1-phenylethylidene)amino]phenol (PubChem CID 100965136) has the molecular formula C18H18F3NO and a molecular weight of 321.34 g/mol. Its IUPAC name is 2-tert-butyl-6-[(2,2,2-trifluoro-1-phenylethylidene)amino]phenol.
| Compound Name | 2-tert-butyl-6-[(2,2,2-trifluoro-1-phenylethylidene)amino]phenol |
|---|---|
| PubChem CID | 100965136 |
| Molecular Formula | C18H18F3NO |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 2-tert-butyl-6-[(2,2,2-trifluoro-1-phenylethylidene)amino]phenol |
| SMILES | CC(C)(C)c1cccc(/N=C(/c2ccccc2)C(F)(F)F)c1O |
| InChI | InChI=1S/C18H18F3NO/c1-17(2,3)13-10-7-11-14(15(13)23)22-16(18(19,20)21)12-8-5-4-6-9-12/h4-11,23H,1-3H3/b22-16- |
| InChIKey | GDZSWIOGUQJANT-JWGURIENSA-N |
| XLogP | 5.37 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|