C19H22N2O — CID 137098307
2-tert-butyl-6-(2,3-dihydro-1H-inden-4-yldiazenyl)phenol (PubChem CID 137098307) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-tert-butyl-6-(2,3-dihydro-1H-inden-4-yldiazenyl)phenol.
| Compound Name | 2-tert-butyl-6-(2,3-dihydro-1H-inden-4-yldiazenyl)phenol |
|---|---|
| PubChem CID | 137098307 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-tert-butyl-6-(2,3-dihydro-1H-inden-4-yldiazenyl)phenol |
| SMILES | CC(C)(C)c1cccc(/N=N/c2cccc3c2CCC3)c1O |
| InChI | InChI=1S/C19H22N2O/c1-19(2,3)15-10-6-12-17(18(15)22)21-20-16-11-5-8-13-7-4-9-14(13)16/h5-6,8,10-12,22H,4,7,9H2,1-3H3/b21-20+ |
| InChIKey | JAYXNKUPFRBBRQ-QZQOTICOSA-N |
| XLogP | 5.59 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|