C16H13Cl2F9N2OSTi — CID 153465270
2-tert-butyl-6-[[2,3,5,6-tetrafluoro-4-(pentafluoro-λ6-sulfanyl)phenyl]diazenyl]phenol;dichlorotitanium (PubChem CID 153465270) has the molecular formula C16H13Cl2F9N2OSTi and a molecular weight of 571.12 g/mol. Its IUPAC name is 2-tert-butyl-6-[[2,3,5,6-tetrafluoro-4-(pentafluoro-λ6-sulfanyl)phenyl]diazenyl]phenol;dichlorotitanium.
| Compound Name | 2-tert-butyl-6-[[2,3,5,6-tetrafluoro-4-(pentafluoro-λ6-sulfanyl)phenyl]diazenyl]phenol;dichlorotitanium |
|---|---|
| PubChem CID | 153465270 |
| Molecular Formula | C16H13Cl2F9N2OSTi |
| Molecular Weight | 571.12 g/mol |
| Exact Mass | 569.95 |
| IUPAC Name | 2-tert-butyl-6-[[2,3,5,6-tetrafluoro-4-(pentafluoro-λ6-sulfanyl)phenyl]diazenyl]phenol;dichlorotitanium |
| SMILES | CC(C)(C)c1cccc(/N=N/c2c(F)c(F)c(S(F)(F)(F)(F)F)c(F)c2F)c1O.Cl[Ti]Cl |
| InChI | InChI=1S/C16H13F9N2OS.2ClH.Ti/c1-16(2,3)7-5-4-6-8(14(7)28)26-27-13-9(17)11(19)15(12(20)10(13)18)29(21,22,23,24)25;;;/h4-6,28H,1-3H3;2*1H;/q;;;+2/p-2/b27-26+;;; |
| InChIKey | BPILNDIKCRPTSP-DTBIJOOYSA-L |
| XLogP | 9.70 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.12 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|