C17H16F15NOS3 — CID 153465269
2-tert-butyl-6-[[2,4,6-tris(pentafluoro-λ6-sulfanyl)phenyl]iminomethyl]phenol (PubChem CID 153465269) has the molecular formula C17H16F15NOS3 and a molecular weight of 631.49 g/mol. Its IUPAC name is 2-tert-butyl-6-[[2,4,6-tris(pentafluoro-λ6-sulfanyl)phenyl]iminomethyl]phenol.
| Compound Name | 2-tert-butyl-6-[[2,4,6-tris(pentafluoro-λ6-sulfanyl)phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 153465269 |
| Molecular Formula | C17H16F15NOS3 |
| Molecular Weight | 631.49 g/mol |
| Exact Mass | 631.02 |
| IUPAC Name | 2-tert-butyl-6-[[2,4,6-tris(pentafluoro-λ6-sulfanyl)phenyl]iminomethyl]phenol |
| SMILES | CC(C)(C)c1cccc(/C=N/c2c(S(F)(F)(F)(F)F)cc(S(F)(F)(F)(F)F)cc2S(F)(F)(F)(F)F)c1O |
| InChI | InChI=1S/C17H16F15NOS3/c1-17(2,3)12-6-4-5-10(16(12)34)9-33-15-13(36(23,24,25,26)27)7-11(35(18,19,20,21)22)8-14(15)37(28,29,30,31)32/h4-9,34H,1-3H3/b33-9+ |
| InChIKey | SAMLZXCHNOTIAO-WMQZSVIDSA-N |
| XLogP | 12.41 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.49 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|