C23H35Cl2NOSi2Zr — CID 137156914
2-[[3,5-bis(trimethylsilyl)phenyl]iminomethyl]-6-tert-butylphenol;dichlorozirconium (PubChem CID 137156914) has the molecular formula C23H35Cl2NOSi2Zr and a molecular weight of 559.84 g/mol. Its IUPAC name is 2-[[3,5-bis(trimethylsilyl)phenyl]iminomethyl]-6-tert-butylphenol;dichlorozirconium.
| Compound Name | 2-[[3,5-bis(trimethylsilyl)phenyl]iminomethyl]-6-tert-butylphenol;dichlorozirconium |
|---|---|
| PubChem CID | 137156914 |
| Molecular Formula | C23H35Cl2NOSi2Zr |
| Molecular Weight | 559.84 g/mol |
| Exact Mass | 557.07 |
| IUPAC Name | 2-[[3,5-bis(trimethylsilyl)phenyl]iminomethyl]-6-tert-butylphenol;dichlorozirconium |
| SMILES | CC(C)(C)c1cccc(/C=N/c2cc([Si](C)(C)C)cc([Si](C)(C)C)c2)c1O.Cl[Zr]Cl |
| InChI | InChI=1S/C23H35NOSi2.2ClH.Zr/c1-23(2,3)21-12-10-11-17(22(21)25)16-24-18-13-19(26(4,5)6)15-20(14-18)27(7,8)9;;;/h10-16,25H,1-9H3;2*1H;/q;;;+2/p-2/b24-16+;;; |
| InChIKey | NNOKJQUASWUDQF-PUHAYJMPSA-L |
| XLogP | 6.91 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.84 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|