C24H31NO — CID 140795252
2-tert-butyl-6-[[1,2,3,5,6,7-hexahydro-s-indacen-4-yl(methyl)amino]methyl]phenol (PubChem CID 140795252) has the molecular formula C24H31NO and a molecular weight of 349.52 g/mol. Its IUPAC name is 2-tert-butyl-6-[[1,2,3,5,6,7-hexahydro-s-indacen-4-yl(methyl)amino]methyl]phenol.
| Compound Name | 2-tert-butyl-6-[[1,2,3,5,6,7-hexahydro-s-indacen-4-yl(methyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 140795252 |
| Molecular Formula | C24H31NO |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 2-tert-butyl-6-[[1,2,3,5,6,7-hexahydro-s-indacen-4-yl(methyl)amino]methyl]phenol |
| SMILES | CN(Cc1cccc(C(C)(C)C)c1O)c1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C24H31NO/c1-24(2,3)21-13-7-10-18(23(21)26)15-25(4)22-19-11-5-8-16(19)14-17-9-6-12-20(17)22/h7,10,13-14,26H,5-6,8-9,11-12,15H2,1-4H3 |
| InChIKey | DBRDGLCAFGLLKQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|