C19H24O — CID 22216122
2-tert-butyl-6-[(2,3-dimethylphenyl)methyl]phenol (PubChem CID 22216122) has the molecular formula C19H24O and a molecular weight of 268.40 g/mol. Its IUPAC name is 2-tert-butyl-6-[(2,3-dimethylphenyl)methyl]phenol.
| Compound Name | 2-tert-butyl-6-[(2,3-dimethylphenyl)methyl]phenol |
|---|---|
| PubChem CID | 22216122 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 2-tert-butyl-6-[(2,3-dimethylphenyl)methyl]phenol |
| SMILES | Cc1cccc(Cc2cccc(C(C)(C)C)c2O)c1C |
| InChI | InChI=1S/C19H24O/c1-13-8-6-9-15(14(13)2)12-16-10-7-11-17(18(16)20)19(3,4)5/h6-11,20H,12H2,1-5H3 |
| InChIKey | JODVLOGKSMRWFN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |