C20H27NO — CID 140654230
2-tert-butyl-6-[(N,2,6-trimethylanilino)methyl]phenol (PubChem CID 140654230) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is 2-tert-butyl-6-[(N,2,6-trimethylanilino)methyl]phenol.
| Compound Name | 2-tert-butyl-6-[(N,2,6-trimethylanilino)methyl]phenol |
|---|---|
| PubChem CID | 140654230 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 2-tert-butyl-6-[(N,2,6-trimethylanilino)methyl]phenol |
| SMILES | Cc1cccc(C)c1N(C)Cc1cccc(C(C)(C)C)c1O |
| InChI | InChI=1S/C20H27NO/c1-14-9-7-10-15(2)18(14)21(6)13-16-11-8-12-17(19(16)22)20(3,4)5/h7-12,22H,13H2,1-6H3 |
| InChIKey | HPODWKRDJORGFJ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|