C15H16FNO — CID 112616193
2-[(N,2-dimethylanilino)methyl]-6-fluorophenol (PubChem CID 112616193) has the molecular formula C15H16FNO and a molecular weight of 245.30 g/mol. Its IUPAC name is 2-[(N,2-dimethylanilino)methyl]-6-fluorophenol.
| Compound Name | 2-[(N,2-dimethylanilino)methyl]-6-fluorophenol |
|---|---|
| PubChem CID | 112616193 |
| Molecular Formula | C15H16FNO |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 2-[(N,2-dimethylanilino)methyl]-6-fluorophenol |
| SMILES | Cc1ccccc1N(C)Cc1cccc(F)c1O |
| InChI | InChI=1S/C15H16FNO/c1-11-6-3-4-9-14(11)17(2)10-12-7-5-8-13(16)15(12)18/h3-9,18H,10H2,1-2H3 |
| InChIKey | RBRSEUOQGVWMBJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|