C19H18BrNO — CID 20604839
6-bromo-3-[(N,2-dimethylanilino)methyl]naphthalen-2-ol (PubChem CID 20604839) has the molecular formula C19H18BrNO and a molecular weight of 356.26 g/mol. Its IUPAC name is 6-bromo-3-[(N,2-dimethylanilino)methyl]naphthalen-2-ol.
| Compound Name | 6-bromo-3-[(N,2-dimethylanilino)methyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 20604839 |
| Molecular Formula | C19H18BrNO |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 6-bromo-3-[(N,2-dimethylanilino)methyl]naphthalen-2-ol |
| SMILES | Cc1ccccc1N(C)Cc1cc2cc(Br)ccc2cc1O |
| InChI | InChI=1S/C19H18BrNO/c1-13-5-3-4-6-18(13)21(2)12-16-9-15-10-17(20)8-7-14(15)11-19(16)22/h3-11,22H,12H2,1-2H3 |
| InChIKey | CGLDGFSAEVVWGS-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|