C18H24N2 — CID 115463927
N,2-dimethyl-N-[[2-[2-(methylamino)ethyl]phenyl]methyl]aniline (PubChem CID 115463927) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is N,2-dimethyl-N-[[2-[2-(methylamino)ethyl]phenyl]methyl]aniline.
| Compound Name | N,2-dimethyl-N-[[2-[2-(methylamino)ethyl]phenyl]methyl]aniline |
|---|---|
| PubChem CID | 115463927 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | N,2-dimethyl-N-[[2-[2-(methylamino)ethyl]phenyl]methyl]aniline |
| SMILES | CNCCc1ccccc1CN(C)c1ccccc1C |
| InChI | InChI=1S/C18H24N2/c1-15-8-4-7-11-18(15)20(3)14-17-10-6-5-9-16(17)12-13-19-2/h4-11,19H,12-14H2,1-3H3 |
| InChIKey | NVKGSTMGGAXNAA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|