C23H33Cl2NOSiZr — CID 123507589
2-tert-butyl-6-[dimethyl-[methyl(5,6,7,8-tetrahydronaphthalen-1-yl)amino]silyl]phenol;dichlorozirconium (PubChem CID 123507589) has the molecular formula C23H33Cl2NOSiZr and a molecular weight of 529.74 g/mol. Its IUPAC name is 2-tert-butyl-6-[dimethyl-[methyl(5,6,7,8-tetrahydronaphthalen-1-yl)amino]silyl]phenol;dichlorozirconium.
| Compound Name | 2-tert-butyl-6-[dimethyl-[methyl(5,6,7,8-tetrahydronaphthalen-1-yl)amino]silyl]phenol;dichlorozirconium |
|---|---|
| PubChem CID | 123507589 |
| Molecular Formula | C23H33Cl2NOSiZr |
| Molecular Weight | 529.74 g/mol |
| Exact Mass | 527.08 |
| IUPAC Name | 2-tert-butyl-6-[dimethyl-[methyl(5,6,7,8-tetrahydronaphthalen-1-yl)amino]silyl]phenol;dichlorozirconium |
| SMILES | CN(c1cccc2c1CCCC2)[Si](C)(C)c1cccc(C(C)(C)C)c1O.Cl[Zr]Cl |
| InChI | InChI=1S/C23H33NOSi.2ClH.Zr/c1-23(2,3)19-14-10-16-21(22(19)25)26(5,6)24(4)20-15-9-12-17-11-7-8-13-18(17)20;;;/h9-10,12,14-16,25H,7-8,11,13H2,1-6H3;2*1H;/q;;;+2/p-2 |
| InChIKey | IDGGGWDJYPDXPH-UHFFFAOYSA-L |
| XLogP | 6.49 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.74 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|