C21H28N2OSi — CID 123985238
2-tert-butyl-6-[[indol-1-yl(methyl)amino]-dimethylsilyl]phenol (PubChem CID 123985238) has the molecular formula C21H28N2OSi and a molecular weight of 352.55 g/mol. Its IUPAC name is 2-tert-butyl-6-[[indol-1-yl(methyl)amino]-dimethylsilyl]phenol.
| Compound Name | 2-tert-butyl-6-[[indol-1-yl(methyl)amino]-dimethylsilyl]phenol |
|---|---|
| PubChem CID | 123985238 |
| Molecular Formula | C21H28N2OSi |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 2-tert-butyl-6-[[indol-1-yl(methyl)amino]-dimethylsilyl]phenol |
| SMILES | CN(n1ccc2ccccc21)[Si](C)(C)c1cccc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H28N2OSi/c1-21(2,3)17-11-9-13-19(20(17)24)25(5,6)22(4)23-15-14-16-10-7-8-12-18(16)23/h7-15,24H,1-6H3 |
| InChIKey | FYPDBAMRTYJPFX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|