About 2-tert-butyl-6-[dimethyl-[methyl(oxolan-2-yl)amino]silyl]phenol;dichlorozirconium
2-tert-butyl-6-[dimethyl-[methyl(oxolan-2-yl)amino]silyl]phenol;dichlorozirconium (PubChem CID 123300836) has the molecular formula C17H29Cl2NO2SiZr
and a molecular weight of 469.64 g/mol. Its IUPAC name is 2-tert-butyl-6-[dimethyl-[methyl(oxolan-2-yl)amino]silyl]phenol;dichlorozirconium.
Molecular Properties
| Compound Name | 2-tert-butyl-6-[dimethyl-[methyl(oxolan-2-yl)amino]silyl]phenol;dichlorozirconium |
| PubChem CID | 123300836 |
| Molecular Formula | C17H29Cl2NO2SiZr |
| Molecular Weight | 469.64 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | 2-tert-butyl-6-[dimethyl-[methyl(oxolan-2-yl)amino]silyl]phenol;dichlorozirconium |
| SMILES | CN(C1CCCO1)[Si](C)(C)c1cccc(C(C)(C)C)c1O.Cl[Zr]Cl |
| InChI | InChI=1S/C17H29NO2Si.2ClH.Zr/c1-17(2,3)13-9-7-10-14(16(13)19)21(5,6)18(4)15-11-8-12-20-15;;;/h7,9-10,15,19H,8,11-12H2,1-6H3;2*1H;/q;;;+2/p-2 |
| InChIKey | AIUKIAOYGYRQNM-UHFFFAOYSA-L |
| XLogP | 4.55 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 469.64 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-6-[dimethyl-[methyl(oxolan-2-yl)amino]silyl]phenol;dichlorozirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-6-[dimethyl-[methyl(oxolan-2-yl)amino]silyl]phenol;dichlorozirconium?
The IUPAC name of 2-tert-butyl-6-[dimethyl-[methyl(oxolan-2-yl)amino]silyl]phenol;dichlorozirconium (CID 123300836) is 2-tert-butyl-6-[dimethyl-[methyl(oxolan-2-yl)amino]silyl]phenol;dichlorozirconium.
What is the SMILES notation for 2-tert-butyl-6-[dimethyl-[methyl(oxolan-2-yl)amino]silyl]phenol;dichlorozirconium?
The canonical SMILES for 2-tert-butyl-6-[dimethyl-[methyl(oxolan-2-yl)amino]silyl]phenol;dichlorozirconium is CN(C1CCCO1)[Si](C)(C)c1cccc(C(C)(C)C)c1O.Cl[Zr]Cl.
What is the InChIKey of 2-tert-butyl-6-[dimethyl-[methyl(oxolan-2-yl)amino]silyl]phenol;dichlorozirconium?
The InChIKey is AIUKIAOYGYRQNM-UHFFFAOYSA-L. The full InChI is InChI=1S/C17H29NO2Si.2ClH.Zr/c1-17(2,3)13-9-7-10-14(16(13)19)21(5,6)18(4)15-11-8-12-20-15;;;/h7,9-10,15,19H,8,11-12H2,1-6H3;2*1H;/q;;;+2/p-2.
What are the key properties of 2-tert-butyl-6-[dimethyl-[methyl(oxolan-2-yl)amino]silyl]phenol;dichlorozirconium?
2-tert-butyl-6-[dimethyl-[methyl(oxolan-2-yl)amino]silyl]phenol;dichlorozirconium has a molecular weight of 469.64 g/mol, XLogP of 4.55, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-6-[dimethyl-[methyl(oxolan-2-yl)amino]silyl]phenol;dichlorozirconium is sourced from PubChem (CID 123300836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).