C17H29Cl2NO2SiZr — CID 123300836
2-tert-butyl-6-[dimethyl-[methyl(oxolan-2-yl)amino]silyl]phenol;dichlorozirconium (PubChem CID 123300836) has the molecular formula C17H29Cl2NO2SiZr and a molecular weight of 469.64 g/mol. Its IUPAC name is 2-tert-butyl-6-[dimethyl-[methyl(oxolan-2-yl)amino]silyl]phenol;dichlorozirconium.
| Compound Name | 2-tert-butyl-6-[dimethyl-[methyl(oxolan-2-yl)amino]silyl]phenol;dichlorozirconium |
|---|---|
| PubChem CID | 123300836 |
| Molecular Formula | C17H29Cl2NO2SiZr |
| Molecular Weight | 469.64 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | 2-tert-butyl-6-[dimethyl-[methyl(oxolan-2-yl)amino]silyl]phenol;dichlorozirconium |
| SMILES | CN(C1CCCO1)[Si](C)(C)c1cccc(C(C)(C)C)c1O.Cl[Zr]Cl |
| InChI | InChI=1S/C17H29NO2Si.2ClH.Zr/c1-17(2,3)13-9-7-10-14(16(13)19)21(5,6)18(4)15-11-8-12-20-15;;;/h7,9-10,15,19H,8,11-12H2,1-6H3;2*1H;/q;;;+2/p-2 |
| InChIKey | AIUKIAOYGYRQNM-UHFFFAOYSA-L |
| XLogP | 4.55 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.64 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|