C16H31NOSi2 — CID 123384663
2-tert-butyl-6-[dimethyl-[methyl(trimethylsilyl)amino]silyl]phenol (PubChem CID 123384663) has the molecular formula C16H31NOSi2 and a molecular weight of 309.60 g/mol. Its IUPAC name is 2-tert-butyl-6-[dimethyl-[methyl(trimethylsilyl)amino]silyl]phenol.
| Compound Name | 2-tert-butyl-6-[dimethyl-[methyl(trimethylsilyl)amino]silyl]phenol |
|---|---|
| PubChem CID | 123384663 |
| Molecular Formula | C16H31NOSi2 |
| Molecular Weight | 309.60 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 2-tert-butyl-6-[dimethyl-[methyl(trimethylsilyl)amino]silyl]phenol |
| SMILES | CN([Si](C)(C)C)[Si](C)(C)c1cccc(C(C)(C)C)c1O |
| InChI | InChI=1S/C16H31NOSi2/c1-16(2,3)13-11-10-12-14(15(13)18)20(8,9)17(4)19(5,6)7/h10-12,18H,1-9H3 |
| InChIKey | XXHKNDHENCRJOG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.60 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|