C19H22F5NOSi — CID 123669813
2-tert-butyl-6-[dimethyl-(2,3,4,5,6-pentafluoro-N-methylanilino)silyl]phenol (PubChem CID 123669813) has the molecular formula C19H22F5NOSi and a molecular weight of 403.47 g/mol. Its IUPAC name is 2-tert-butyl-6-[dimethyl-(2,3,4,5,6-pentafluoro-N-methylanilino)silyl]phenol.
| Compound Name | 2-tert-butyl-6-[dimethyl-(2,3,4,5,6-pentafluoro-N-methylanilino)silyl]phenol |
|---|---|
| PubChem CID | 123669813 |
| Molecular Formula | C19H22F5NOSi |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 2-tert-butyl-6-[dimethyl-(2,3,4,5,6-pentafluoro-N-methylanilino)silyl]phenol |
| SMILES | CN(c1c(F)c(F)c(F)c(F)c1F)[Si](C)(C)c1cccc(C(C)(C)C)c1O |
| InChI | InChI=1S/C19H22F5NOSi/c1-19(2,3)10-8-7-9-11(18(10)26)27(5,6)25(4)17-15(23)13(21)12(20)14(22)16(17)24/h7-9,26H,1-6H3 |
| InChIKey | OPRIRRPRSLFVJK-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|