C12H13Cl3O2 — CID 14613452
1-(3-tert-butyl-2-hydroxyphenyl)-2,2,2-trichloroethanone (PubChem CID 14613452) has the molecular formula C12H13Cl3O2 and a molecular weight of 295.59 g/mol. Its IUPAC name is 1-(3-tert-butyl-2-hydroxyphenyl)-2,2,2-trichloroethanone.
| Compound Name | 1-(3-tert-butyl-2-hydroxyphenyl)-2,2,2-trichloroethanone |
|---|---|
| PubChem CID | 14613452 |
| Molecular Formula | C12H13Cl3O2 |
| Molecular Weight | 295.59 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 1-(3-tert-butyl-2-hydroxyphenyl)-2,2,2-trichloroethanone |
| SMILES | CC(C)(C)c1cccc(C(=O)C(Cl)(Cl)Cl)c1O |
| InChI | InChI=1S/C12H13Cl3O2/c1-11(2,3)8-6-4-5-7(9(8)16)10(17)12(13,14)15/h4-6,16H,1-3H3 |
| InChIKey | FRCPSGICAQWINX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.59 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|