About 3-tert-butyl-2-hydroxybenzoic acid;diphenyl carbonate
3-tert-butyl-2-hydroxybenzoic acid;diphenyl carbonate (PubChem CID 87346943) has the molecular formula C24H24O6
and a molecular weight of 408.45 g/mol. Its IUPAC name is 3-tert-butyl-2-hydroxybenzoic acid;diphenyl carbonate.
Molecular Properties
| Compound Name | 3-tert-butyl-2-hydroxybenzoic acid;diphenyl carbonate |
| PubChem CID | 87346943 |
| Molecular Formula | C24H24O6 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 3-tert-butyl-2-hydroxybenzoic acid;diphenyl carbonate |
| SMILES | CC(C)(C)c1cccc(C(=O)O)c1O.O=C(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C13H10O3.C11H14O3/c14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12;1-11(2,3)8-6-4-5-7(9(8)12)10(13)14/h1-10H;4-6,12H,1-3H3,(H,13,14) |
| InChIKey | QIJKBHQEOMJWHT-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-2-hydroxybenzoic acid;diphenyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-2-hydroxybenzoic acid;diphenyl carbonate?
The IUPAC name of 3-tert-butyl-2-hydroxybenzoic acid;diphenyl carbonate (CID 87346943) is 3-tert-butyl-2-hydroxybenzoic acid;diphenyl carbonate.
What is the SMILES notation for 3-tert-butyl-2-hydroxybenzoic acid;diphenyl carbonate?
The canonical SMILES for 3-tert-butyl-2-hydroxybenzoic acid;diphenyl carbonate is CC(C)(C)c1cccc(C(=O)O)c1O.O=C(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of 3-tert-butyl-2-hydroxybenzoic acid;diphenyl carbonate?
The InChIKey is QIJKBHQEOMJWHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O3.C11H14O3/c14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12;1-11(2,3)8-6-4-5-7(9(8)12)10(13)14/h1-10H;4-6,12H,1-3H3,(H,13,14).
What are the key properties of 3-tert-butyl-2-hydroxybenzoic acid;diphenyl carbonate?
3-tert-butyl-2-hydroxybenzoic acid;diphenyl carbonate has a molecular weight of 408.45 g/mol, XLogP of 5.65, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-2-hydroxybenzoic acid;diphenyl carbonate is sourced from PubChem (CID 87346943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).