C29H42O — CID 154326644
bis(2,6-ditert-butylphenyl)methanone (PubChem CID 154326644) has the molecular formula C29H42O and a molecular weight of 406.65 g/mol. Its IUPAC name is bis(2,6-ditert-butylphenyl)methanone.
| Compound Name | bis(2,6-ditert-butylphenyl)methanone |
|---|---|
| PubChem CID | 154326644 |
| Molecular Formula | C29H42O |
| Molecular Weight | 406.65 g/mol |
| Exact Mass | 406.32 |
| IUPAC Name | bis(2,6-ditert-butylphenyl)methanone |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1C(=O)c1c(C(C)(C)C)cccc1C(C)(C)C |
| InChI | InChI=1S/C29H42O/c1-26(2,3)19-15-13-16-20(27(4,5)6)23(19)25(30)24-21(28(7,8)9)17-14-18-22(24)29(10,11)12/h13-18H,1-12H3 |
| InChIKey | DKEGXGMZEXUZJS-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.65 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |