C16H25NO — CID 66973629
2-tert-butyl-6-(2,2-dimethylpropyl)benzamide (PubChem CID 66973629) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is 2-tert-butyl-6-(2,2-dimethylpropyl)benzamide.
| Compound Name | 2-tert-butyl-6-(2,2-dimethylpropyl)benzamide |
|---|---|
| PubChem CID | 66973629 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 2-tert-butyl-6-(2,2-dimethylpropyl)benzamide |
| SMILES | CC(C)(C)Cc1cccc(C(C)(C)C)c1C(N)=O |
| InChI | InChI=1S/C16H25NO/c1-15(2,3)10-11-8-7-9-12(16(4,5)6)13(11)14(17)18/h7-9H,10H2,1-6H3,(H2,17,18) |
| InChIKey | OQGGDKNIOJTGPW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |