About 1-tert-butyl-2-tert-butylsulfanylbenzene;1-tert-butyl-2-(2,2-dimethylpropyl)benzene
1-tert-butyl-2-tert-butylsulfanylbenzene;1-tert-butyl-2-(2,2-dimethylpropyl)benzene (PubChem CID 160876364) has the molecular formula C29H46S
and a molecular weight of 426.75 g/mol. Its IUPAC name is 1-tert-butyl-2-tert-butylsulfanylbenzene;1-tert-butyl-2-(2,2-dimethylpropyl)benzene.
Molecular Properties
| Compound Name | 1-tert-butyl-2-tert-butylsulfanylbenzene;1-tert-butyl-2-(2,2-dimethylpropyl)benzene |
| PubChem CID | 160876364 |
| Molecular Formula | C29H46S |
| Molecular Weight | 426.75 g/mol |
| Exact Mass | 426.33 |
| IUPAC Name | 1-tert-butyl-2-tert-butylsulfanylbenzene;1-tert-butyl-2-(2,2-dimethylpropyl)benzene |
| SMILES | CC(C)(C)Cc1ccccc1C(C)(C)C.CC(C)(C)Sc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C15H24.C14H22S/c1-14(2,3)11-12-9-7-8-10-13(12)15(4,5)6;1-13(2,3)11-9-7-8-10-12(11)15-14(4,5)6/h7-10H,11H2,1-6H3;7-10H,1-6H3 |
| InChIKey | SMLGVMOMMRFFRV-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.75 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-tert-butyl-2-tert-butylsulfanylbenzene;1-tert-butyl-2-(2,2-dimethylpropyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-2-tert-butylsulfanylbenzene;1-tert-butyl-2-(2,2-dimethylpropyl)benzene?
The IUPAC name of 1-tert-butyl-2-tert-butylsulfanylbenzene;1-tert-butyl-2-(2,2-dimethylpropyl)benzene (CID 160876364) is 1-tert-butyl-2-tert-butylsulfanylbenzene;1-tert-butyl-2-(2,2-dimethylpropyl)benzene.
What is the SMILES notation for 1-tert-butyl-2-tert-butylsulfanylbenzene;1-tert-butyl-2-(2,2-dimethylpropyl)benzene?
The canonical SMILES for 1-tert-butyl-2-tert-butylsulfanylbenzene;1-tert-butyl-2-(2,2-dimethylpropyl)benzene is CC(C)(C)Cc1ccccc1C(C)(C)C.CC(C)(C)Sc1ccccc1C(C)(C)C.
What is the InChIKey of 1-tert-butyl-2-tert-butylsulfanylbenzene;1-tert-butyl-2-(2,2-dimethylpropyl)benzene?
The InChIKey is SMLGVMOMMRFFRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24.C14H22S/c1-14(2,3)11-12-9-7-8-10-13(12)15(4,5)6;1-13(2,3)11-9-7-8-10-12(11)15-14(4,5)6/h7-10H,11H2,1-6H3;7-10H,1-6H3.
What are the key properties of 1-tert-butyl-2-tert-butylsulfanylbenzene;1-tert-butyl-2-(2,2-dimethylpropyl)benzene?
1-tert-butyl-2-tert-butylsulfanylbenzene;1-tert-butyl-2-(2,2-dimethylpropyl)benzene has a molecular weight of 426.75 g/mol, XLogP of 9.45, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-2-tert-butylsulfanylbenzene;1-tert-butyl-2-(2,2-dimethylpropyl)benzene is sourced from PubChem (CID 160876364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).