C18H31NOSi — CID 123383962
2-tert-butyl-6-[[cyclopentyl(methyl)amino]-dimethylsilyl]phenol (PubChem CID 123383962) has the molecular formula C18H31NOSi and a molecular weight of 305.54 g/mol. Its IUPAC name is 2-tert-butyl-6-[[cyclopentyl(methyl)amino]-dimethylsilyl]phenol.
| Compound Name | 2-tert-butyl-6-[[cyclopentyl(methyl)amino]-dimethylsilyl]phenol |
|---|---|
| PubChem CID | 123383962 |
| Molecular Formula | C18H31NOSi |
| Molecular Weight | 305.54 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | 2-tert-butyl-6-[[cyclopentyl(methyl)amino]-dimethylsilyl]phenol |
| SMILES | CN(C1CCCC1)[Si](C)(C)c1cccc(C(C)(C)C)c1O |
| InChI | InChI=1S/C18H31NOSi/c1-18(2,3)15-12-9-13-16(17(15)20)21(5,6)19(4)14-10-7-8-11-14/h9,12-14,20H,7-8,10-11H2,1-6H3 |
| InChIKey | BHMTWYHNXHPPNH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|