About N,N-dimethylindol-1-amine;methane
N,N-dimethylindol-1-amine;methane (PubChem CID 159899894) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is N,N-dimethylindol-1-amine;methane.
Molecular Properties
| Compound Name | N,N-dimethylindol-1-amine;methane |
| PubChem CID | 159899894 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | N,N-dimethylindol-1-amine;methane |
| SMILES | C.CN(C)n1ccc2ccccc21 |
| InChI | InChI=1S/C10H12N2.CH4/c1-11(2)12-8-7-9-5-3-4-6-10(9)12;/h3-8H,1-2H3;1H4 |
| InChIKey | NVUXFHZDNFLCMF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethylindol-1-amine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylindol-1-amine;methane?
The IUPAC name of N,N-dimethylindol-1-amine;methane (CID 159899894) is N,N-dimethylindol-1-amine;methane.
What is the SMILES notation for N,N-dimethylindol-1-amine;methane?
The canonical SMILES for N,N-dimethylindol-1-amine;methane is C.CN(C)n1ccc2ccccc21.
What is the InChIKey of N,N-dimethylindol-1-amine;methane?
The InChIKey is NVUXFHZDNFLCMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2.CH4/c1-11(2)12-8-7-9-5-3-4-6-10(9)12;/h3-8H,1-2H3;1H4.
What are the key properties of N,N-dimethylindol-1-amine;methane?
N,N-dimethylindol-1-amine;methane has a molecular weight of 176.26 g/mol, XLogP of 2.47, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylindol-1-amine;methane is sourced from PubChem (CID 159899894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).