C15H9F3N2 — CID 86081587
4-[(2,2,2-trifluoro-1-phenylethylidene)amino]benzonitrile (PubChem CID 86081587) has the molecular formula C15H9F3N2 and a molecular weight of 274.25 g/mol. Its IUPAC name is 4-[(2,2,2-trifluoro-1-phenylethylidene)amino]benzonitrile.
| Compound Name | 4-[(2,2,2-trifluoro-1-phenylethylidene)amino]benzonitrile |
|---|---|
| PubChem CID | 86081587 |
| Molecular Formula | C15H9F3N2 |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 4-[(2,2,2-trifluoro-1-phenylethylidene)amino]benzonitrile |
| SMILES | N#Cc1ccc(/N=C(/c2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H9F3N2/c16-15(17,18)14(12-4-2-1-3-5-12)20-13-8-6-11(10-19)7-9-13/h1-9H/b20-14- |
| InChIKey | DCKUFWPXQDIAAR-ZHZULCJRSA-N |
| XLogP | 4.24 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|