C10H11F3N2 — CID 138963203
N-methyl-N-[(Z)-(2,2,2-trifluoro-1-phenylethylidene)amino]methanamine (PubChem CID 138963203) has the molecular formula C10H11F3N2 and a molecular weight of 216.21 g/mol. Its IUPAC name is N-methyl-N-[(Z)-(2,2,2-trifluoro-1-phenylethylidene)amino]methanamine.
| Compound Name | N-methyl-N-[(Z)-(2,2,2-trifluoro-1-phenylethylidene)amino]methanamine |
|---|---|
| PubChem CID | 138963203 |
| Molecular Formula | C10H11F3N2 |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | N-methyl-N-[(Z)-(2,2,2-trifluoro-1-phenylethylidene)amino]methanamine |
| SMILES | CN(C)/N=C(/c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H11F3N2/c1-15(2)14-9(10(11,12)13)8-6-4-3-5-7-8/h3-7H,1-2H3/b14-9- |
| InChIKey | HLKJSZJMBXZBRU-ZROIWOOFSA-N |
| XLogP | 2.51 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|