C12H18N2O2 — CID 6376974
N-[(E)-(2,2-dimethoxy-1-phenylethylidene)amino]-N-methylmethanamine (PubChem CID 6376974) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is N-[(E)-(2,2-dimethoxy-1-phenylethylidene)amino]-N-methylmethanamine.
| Compound Name | N-[(E)-(2,2-dimethoxy-1-phenylethylidene)amino]-N-methylmethanamine |
|---|---|
| PubChem CID | 6376974 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | N-[(E)-(2,2-dimethoxy-1-phenylethylidene)amino]-N-methylmethanamine |
| SMILES | COC(OC)/C(=N/N(C)C)c1ccccc1 |
| InChI | InChI=1S/C12H18N2O2/c1-14(2)13-11(12(15-3)16-4)10-8-6-5-7-9-10/h5-9,12H,1-4H3/b13-11+ |
| InChIKey | VTZVILPRFZFJKX-ACCUITESSA-N |
| XLogP | 1.57 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|