C15H15NO2 — CID 10922703
(2Z)-2-methoxyimino-1,2-diphenylethanol (PubChem CID 10922703) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is (2Z)-2-methoxyimino-1,2-diphenylethanol.
| Compound Name | (2Z)-2-methoxyimino-1,2-diphenylethanol |
|---|---|
| PubChem CID | 10922703 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | (2Z)-2-methoxyimino-1,2-diphenylethanol |
| SMILES | CO/N=C(/c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C15H15NO2/c1-18-16-14(12-8-4-2-5-9-12)15(17)13-10-6-3-7-11-13/h2-11,15,17H,1H3/b16-14- |
| InChIKey | LCFHZZBCOOREKS-PEZBUJJGSA-N |
| XLogP | 2.77 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|