C30H26N4O4 — CID 132833444
N,N'-bis[(E)-(2-hydroxy-1,2-diphenylethylidene)amino]oxamide (PubChem CID 132833444) has the molecular formula C30H26N4O4 and a molecular weight of 506.56 g/mol. Its IUPAC name is N,N'-bis[(E)-(2-hydroxy-1,2-diphenylethylidene)amino]oxamide.
| Compound Name | N,N'-bis[(E)-(2-hydroxy-1,2-diphenylethylidene)amino]oxamide |
|---|---|
| PubChem CID | 132833444 |
| Molecular Formula | C30H26N4O4 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | N,N'-bis[(E)-(2-hydroxy-1,2-diphenylethylidene)amino]oxamide |
| SMILES | O=C(N/N=C(\c1ccccc1)C(O)c1ccccc1)C(=O)N/N=C(\c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C30H26N4O4/c35-27(23-17-9-3-10-18-23)25(21-13-5-1-6-14-21)31-33-29(37)30(38)34-32-26(22-15-7-2-8-16-22)28(36)24-19-11-4-12-20-24/h1-20,27-28,35-36H,(H,33,37)(H,34,38)/b31-25+,32-26+ |
| InChIKey | XNVGDBHZVAAMLO-YESHOFFLSA-N |
| XLogP | 3.49 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|